C24H26ClN3O3 — CID 56595410
N-(furan-2-ylmethyl)-N'-[7-(4-methoxyphenoxy)quinolin-4-yl]propane-1,3-diamine;hydrochloride (PubChem CID 56595410) has the molecular formula C24H26ClN3O3 and a molecular weight of 439.94 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N'-[7-(4-methoxyphenoxy)quinolin-4-yl]propane-1,3-diamine;hydrochloride.
| Compound Name | N-(furan-2-ylmethyl)-N'-[7-(4-methoxyphenoxy)quinolin-4-yl]propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 56595410 |
| Molecular Formula | C24H26ClN3O3 |
| Molecular Weight | 439.94 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-N'-[7-(4-methoxyphenoxy)quinolin-4-yl]propane-1,3-diamine;hydrochloride |
| SMILES | COc1ccc(Oc2ccc3c(NCCCNCc4ccco4)ccnc3c2)cc1.Cl |
| InChI | InChI=1S/C24H25N3O3.ClH/c1-28-18-5-7-19(8-6-18)30-20-9-10-22-23(11-14-27-24(22)16-20)26-13-3-12-25-17-21-4-2-15-29-21;/h2,4-11,14-16,25H,3,12-13,17H2,1H3,(H,26,27);1H |
| InChIKey | YKRKJWQHHWYAAM-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 68.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.94 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|