C27H27Cl2N3O2 — CID 162444675
2-[[3-[[7-[(2,6-dichlorophenyl)methyl]quinolin-4-yl]amino]propylamino]methyl]-6-methoxyphenol (PubChem CID 162444675) has the molecular formula C27H27Cl2N3O2 and a molecular weight of 496.44 g/mol. Its IUPAC name is 2-[[3-[[7-[(2,6-dichlorophenyl)methyl]quinolin-4-yl]amino]propylamino]methyl]-6-methoxyphenol.
| Compound Name | 2-[[3-[[7-[(2,6-dichlorophenyl)methyl]quinolin-4-yl]amino]propylamino]methyl]-6-methoxyphenol |
|---|---|
| PubChem CID | 162444675 |
| Molecular Formula | C27H27Cl2N3O2 |
| Molecular Weight | 496.44 g/mol |
| Exact Mass | 495.15 |
| IUPAC Name | 2-[[3-[[7-[(2,6-dichlorophenyl)methyl]quinolin-4-yl]amino]propylamino]methyl]-6-methoxyphenol |
| SMILES | COc1cccc(CNCCCNc2ccnc3cc(Cc4c(Cl)cccc4Cl)ccc23)c1O |
| InChI | InChI=1S/C27H27Cl2N3O2/c1-34-26-8-2-5-19(27(26)33)17-30-12-4-13-31-24-11-14-32-25-16-18(9-10-20(24)25)15-21-22(28)6-3-7-23(21)29/h2-3,5-11,14,16,30,33H,4,12-13,15,17H2,1H3,(H,31,32) |
| InChIKey | MZCSWZAKRVCBSF-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.44 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|