C28H29ClN4O2 — CID 56595417
4-[[4-[3-[(2-hydroxy-3-methoxyphenyl)methylamino]propylamino]quinolin-7-yl]methyl]benzonitrile;hydrochloride (PubChem CID 56595417) has the molecular formula C28H29ClN4O2 and a molecular weight of 489.02 g/mol. Its IUPAC name is 4-[[4-[3-[(2-hydroxy-3-methoxyphenyl)methylamino]propylamino]quinolin-7-yl]methyl]benzonitrile;hydrochloride.
| Compound Name | 4-[[4-[3-[(2-hydroxy-3-methoxyphenyl)methylamino]propylamino]quinolin-7-yl]methyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 56595417 |
| Molecular Formula | C28H29ClN4O2 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | 4-[[4-[3-[(2-hydroxy-3-methoxyphenyl)methylamino]propylamino]quinolin-7-yl]methyl]benzonitrile;hydrochloride |
| SMILES | COc1cccc(CNCCCNc2ccnc3cc(Cc4ccc(C#N)cc4)ccc23)c1O.Cl |
| InChI | InChI=1S/C28H28N4O2.ClH/c1-34-27-5-2-4-23(28(27)33)19-30-13-3-14-31-25-12-15-32-26-17-22(10-11-24(25)26)16-20-6-8-21(18-29)9-7-20;/h2,4-12,15,17,30,33H,3,13-14,16,19H2,1H3,(H,31,32);1H |
| InChIKey | YZVJLCOMDZBSTP-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 90.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|