C26H27ClFN3O2 — CID 56595153
2-[[3-[[7-(4-fluorophenyl)quinolin-4-yl]amino]propylamino]methyl]-6-methoxyphenol;hydrochloride (PubChem CID 56595153) has the molecular formula C26H27ClFN3O2 and a molecular weight of 467.97 g/mol. Its IUPAC name is 2-[[3-[[7-(4-fluorophenyl)quinolin-4-yl]amino]propylamino]methyl]-6-methoxyphenol;hydrochloride.
| Compound Name | 2-[[3-[[7-(4-fluorophenyl)quinolin-4-yl]amino]propylamino]methyl]-6-methoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 56595153 |
| Molecular Formula | C26H27ClFN3O2 |
| Molecular Weight | 467.97 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | 2-[[3-[[7-(4-fluorophenyl)quinolin-4-yl]amino]propylamino]methyl]-6-methoxyphenol;hydrochloride |
| SMILES | COc1cccc(CNCCCNc2ccnc3cc(-c4ccc(F)cc4)ccc23)c1O.Cl |
| InChI | InChI=1S/C26H26FN3O2.ClH/c1-32-25-5-2-4-20(26(25)31)17-28-13-3-14-29-23-12-15-30-24-16-19(8-11-22(23)24)18-6-9-21(27)10-7-18;/h2,4-12,15-16,28,31H,3,13-14,17H2,1H3,(H,29,30);1H |
| InChIKey | MOPRIWXHTAXJJZ-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.97 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|