C17H18ClN3S — CID 155513408
N'-(7-chloroquinolin-4-yl)-N-(thiophen-2-ylmethyl)propane-1,3-diamine (PubChem CID 155513408) has the molecular formula C17H18ClN3S and a molecular weight of 331.87 g/mol. Its IUPAC name is N'-(7-chloroquinolin-4-yl)-N-(thiophen-2-ylmethyl)propane-1,3-diamine.
| Compound Name | N'-(7-chloroquinolin-4-yl)-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 155513408 |
| Molecular Formula | C17H18ClN3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | N'-(7-chloroquinolin-4-yl)-N-(thiophen-2-ylmethyl)propane-1,3-diamine |
| SMILES | Clc1ccc2c(NCCCNCc3cccs3)ccnc2c1 |
| InChI | InChI=1S/C17H18ClN3S/c18-13-4-5-15-16(6-9-21-17(15)11-13)20-8-2-7-19-12-14-3-1-10-22-14/h1,3-6,9-11,19H,2,7-8,12H2,(H,20,21) |
| InChIKey | CGBWRDKLQRLMOT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|