C26H31ClFeN4+2 — CID 10553106
CID 10553106 (PubChem CID 10553106) has the molecular formula C26H31ClFeN4+2 and a molecular weight of 490.86 g/mol.
| Compound Name | CID 10553106 |
|---|---|
| PubChem CID | 10553106 |
| Molecular Formula | C26H31ClFeN4+2 |
| Molecular Weight | 490.86 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | — |
| SMILES | CN(C)C[C]1[CH][CH][CH][C]1CNCCCNc1ccnc2cc(Cl)ccc12.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C21H26ClN4.C5H5.Fe/c1-26(2)15-17-6-3-5-16(17)14-23-10-4-11-24-20-9-12-25-21-13-18(22)7-8-19(20)21;1-2-4-5-3-1;/h3,5-9,12-13,23H,4,10-11,14-15H2,1-2H3,(H,24,25);1-5H;/q;;+2 |
| InChIKey | CEAUQOVLVRLPGJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.86 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|