C17H17ClN3 — CID 10409748
CID 10409748 (PubChem CID 10409748) has the molecular formula C17H17ClN3 and a molecular weight of 298.80 g/mol.
| Compound Name | CID 10409748 |
|---|---|
| PubChem CID | 10409748 |
| Molecular Formula | C17H17ClN3 |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | — |
| SMILES | CNC[C]1[CH][CH][CH][C]1CNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C17H17ClN3/c1-19-10-12-3-2-4-13(12)11-21-16-7-8-20-17-9-14(18)5-6-15(16)17/h2-9,19H,10-11H2,1H3,(H,20,21) |
| InChIKey | RGOUJWWCQXXEBX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |