C15H19ClN2O — CID 62060056
3-[[(7-chloroquinolin-4-yl)amino]methyl]pentan-3-ol (PubChem CID 62060056) has the molecular formula C15H19ClN2O and a molecular weight of 278.78 g/mol. Its IUPAC name is 3-[[(7-chloroquinolin-4-yl)amino]methyl]pentan-3-ol.
| Compound Name | 3-[[(7-chloroquinolin-4-yl)amino]methyl]pentan-3-ol |
|---|---|
| PubChem CID | 62060056 |
| Molecular Formula | C15H19ClN2O |
| Molecular Weight | 278.78 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 3-[[(7-chloroquinolin-4-yl)amino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H19ClN2O/c1-3-15(19,4-2)10-18-13-7-8-17-14-9-11(16)5-6-12(13)14/h5-9,19H,3-4,10H2,1-2H3,(H,17,18) |
| InChIKey | QUTHTLKOLILZDP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |