C16H21ClN2O — CID 104624105
7-chloro-N-(4-methoxy-2,2-dimethylbutyl)quinolin-4-amine (PubChem CID 104624105) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 7-chloro-N-(4-methoxy-2,2-dimethylbutyl)quinolin-4-amine.
| Compound Name | 7-chloro-N-(4-methoxy-2,2-dimethylbutyl)quinolin-4-amine |
|---|---|
| PubChem CID | 104624105 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 7-chloro-N-(4-methoxy-2,2-dimethylbutyl)quinolin-4-amine |
| SMILES | COCCC(C)(C)CNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C16H21ClN2O/c1-16(2,7-9-20-3)11-19-14-6-8-18-15-10-12(17)4-5-13(14)15/h4-6,8,10H,7,9,11H2,1-3H3,(H,18,19) |
| InChIKey | TXHGVUHYFIIASY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |