C17H15Cl2N3S — CID 59856964
2-(4-chlorophenyl)-N-[[5-(2-chloropyrimidin-4-yl)thiophen-2-yl]methyl]ethanamine (PubChem CID 59856964) has the molecular formula C17H15Cl2N3S and a molecular weight of 364.30 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[[5-(2-chloropyrimidin-4-yl)thiophen-2-yl]methyl]ethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-[[5-(2-chloropyrimidin-4-yl)thiophen-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 59856964 |
| Molecular Formula | C17H15Cl2N3S |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[[5-(2-chloropyrimidin-4-yl)thiophen-2-yl]methyl]ethanamine |
| SMILES | Clc1ccc(CCNCc2ccc(-c3ccnc(Cl)n3)s2)cc1 |
| InChI | InChI=1S/C17H15Cl2N3S/c18-13-3-1-12(2-4-13)7-9-20-11-14-5-6-16(23-14)15-8-10-21-17(19)22-15/h1-6,8,10,20H,7,9,11H2 |
| InChIKey | UZJCRVCDKASLRP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|