C17H18ClN3 — CID 71594262
N'-(7-chloroquinolin-4-yl)-N-(cyclopenta-1,3-dien-1-ylmethyl)ethane-1,2-diamine (PubChem CID 71594262) has the molecular formula C17H18ClN3 and a molecular weight of 299.81 g/mol. Its IUPAC name is N'-(7-chloroquinolin-4-yl)-N-(cyclopenta-1,3-dien-1-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(7-chloroquinolin-4-yl)-N-(cyclopenta-1,3-dien-1-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 71594262 |
| Molecular Formula | C17H18ClN3 |
| Molecular Weight | 299.81 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | N'-(7-chloroquinolin-4-yl)-N-(cyclopenta-1,3-dien-1-ylmethyl)ethane-1,2-diamine |
| SMILES | Clc1ccc2c(NCCNCC3=CC=CC3)ccnc2c1 |
| InChI | InChI=1S/C17H18ClN3/c18-14-5-6-15-16(7-8-20-17(15)11-14)21-10-9-19-12-13-3-1-2-4-13/h1-3,5-8,11,19H,4,9-10,12H2,(H,20,21) |
| InChIKey | SIZNGODGAOXUOG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.81 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|