C18H19ClN4O2 — CID 118707267
2-[[2-[(7-chloroquinolin-4-yl)amino]ethylamino]methyl]-5-hydroxy-1-methylpyridin-4-one (PubChem CID 118707267) has the molecular formula C18H19ClN4O2 and a molecular weight of 358.83 g/mol. Its IUPAC name is 2-[[2-[(7-chloroquinolin-4-yl)amino]ethylamino]methyl]-5-hydroxy-1-methylpyridin-4-one.
| Compound Name | 2-[[2-[(7-chloroquinolin-4-yl)amino]ethylamino]methyl]-5-hydroxy-1-methylpyridin-4-one |
|---|---|
| PubChem CID | 118707267 |
| Molecular Formula | C18H19ClN4O2 |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 2-[[2-[(7-chloroquinolin-4-yl)amino]ethylamino]methyl]-5-hydroxy-1-methylpyridin-4-one |
| SMILES | Cn1cc(O)c(=O)cc1CNCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H19ClN4O2/c1-23-11-18(25)17(24)9-13(23)10-20-6-7-22-15-4-5-21-16-8-12(19)2-3-14(15)16/h2-5,8-9,11,20,25H,6-7,10H2,1H3,(H,21,22) |
| InChIKey | ZGYTWPGMMKYNBY-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|