C20H21ClN4O2 — CID 118705908
2-[[2-[(7-chloroquinolin-4-yl)amino]ethylamino]methyl]-1-cyclopropyl-5-hydroxypyridin-4-one (PubChem CID 118705908) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 2-[[2-[(7-chloroquinolin-4-yl)amino]ethylamino]methyl]-1-cyclopropyl-5-hydroxypyridin-4-one.
| Compound Name | 2-[[2-[(7-chloroquinolin-4-yl)amino]ethylamino]methyl]-1-cyclopropyl-5-hydroxypyridin-4-one |
|---|---|
| PubChem CID | 118705908 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 2-[[2-[(7-chloroquinolin-4-yl)amino]ethylamino]methyl]-1-cyclopropyl-5-hydroxypyridin-4-one |
| SMILES | O=c1cc(CNCCNc2ccnc3cc(Cl)ccc23)n(C2CC2)cc1O |
| InChI | InChI=1S/C20H21ClN4O2/c21-13-1-4-16-17(5-6-23-18(16)9-13)24-8-7-22-11-15-10-19(26)20(27)12-25(15)14-2-3-14/h1,4-6,9-10,12,14,22,27H,2-3,7-8,11H2,(H,23,24) |
| InChIKey | UNTNQNFGAKCMMM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|