C26H20Cl2N4 — CID 18933497
N-[[4-[amino-(7-chloroquinolin-4-yl)methyl]phenyl]methyl]-7-chloroquinolin-4-amine (PubChem CID 18933497) has the molecular formula C26H20Cl2N4 and a molecular weight of 459.38 g/mol. Its IUPAC name is N-[[4-[amino-(7-chloroquinolin-4-yl)methyl]phenyl]methyl]-7-chloroquinolin-4-amine.
| Compound Name | N-[[4-[amino-(7-chloroquinolin-4-yl)methyl]phenyl]methyl]-7-chloroquinolin-4-amine |
|---|---|
| PubChem CID | 18933497 |
| Molecular Formula | C26H20Cl2N4 |
| Molecular Weight | 459.38 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | N-[[4-[amino-(7-chloroquinolin-4-yl)methyl]phenyl]methyl]-7-chloroquinolin-4-amine |
| SMILES | NC(c1ccc(CNc2ccnc3cc(Cl)ccc23)cc1)c1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H20Cl2N4/c27-18-5-7-20-21(9-11-30-24(20)13-18)26(29)17-3-1-16(2-4-17)15-32-23-10-12-31-25-14-19(28)6-8-22(23)25/h1-14,26H,15,29H2,(H,31,32) |
| InChIKey | LTSCIGXJSFLYMD-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.38 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |