C22H29Cl3N4 — CID 158200125
1-(7-chloroquinolin-4-yl)-2-N-[[4-(dimethylamino)phenyl]methyl]-2-methylpropane-1,2-diamine;dihydrochloride (PubChem CID 158200125) has the molecular formula C22H29Cl3N4 and a molecular weight of 455.86 g/mol. Its IUPAC name is 1-(7-chloroquinolin-4-yl)-2-N-[[4-(dimethylamino)phenyl]methyl]-2-methylpropane-1,2-diamine;dihydrochloride.
| Compound Name | 1-(7-chloroquinolin-4-yl)-2-N-[[4-(dimethylamino)phenyl]methyl]-2-methylpropane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 158200125 |
| Molecular Formula | C22H29Cl3N4 |
| Molecular Weight | 455.86 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | 1-(7-chloroquinolin-4-yl)-2-N-[[4-(dimethylamino)phenyl]methyl]-2-methylpropane-1,2-diamine;dihydrochloride |
| SMILES | CN(C)c1ccc(CNC(C)(C)C(N)c2ccnc3cc(Cl)ccc23)cc1.Cl.Cl |
| InChI | InChI=1S/C22H27ClN4.2ClH/c1-22(2,26-14-15-5-8-17(9-6-15)27(3)4)21(24)19-11-12-25-20-13-16(23)7-10-18(19)20;;/h5-13,21,26H,14,24H2,1-4H3;2*1H |
| InChIKey | KDOGXVBZUGJJBK-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.86 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|