C27H29ClN4 — CID 90990335
7-chloro-N-[[3-[2-[4-(dimethylamino)phenyl]-1-(methylamino)ethyl]phenyl]methyl]quinolin-4-amine (PubChem CID 90990335) has the molecular formula C27H29ClN4 and a molecular weight of 445.01 g/mol. Its IUPAC name is 7-chloro-N-[[3-[2-[4-(dimethylamino)phenyl]-1-(methylamino)ethyl]phenyl]methyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[[3-[2-[4-(dimethylamino)phenyl]-1-(methylamino)ethyl]phenyl]methyl]quinolin-4-amine |
|---|---|
| PubChem CID | 90990335 |
| Molecular Formula | C27H29ClN4 |
| Molecular Weight | 445.01 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | 7-chloro-N-[[3-[2-[4-(dimethylamino)phenyl]-1-(methylamino)ethyl]phenyl]methyl]quinolin-4-amine |
| SMILES | CNC(Cc1ccc(N(C)C)cc1)c1cccc(CNc2ccnc3cc(Cl)ccc23)c1 |
| InChI | InChI=1S/C27H29ClN4/c1-29-26(16-19-7-10-23(11-8-19)32(2)3)21-6-4-5-20(15-21)18-31-25-13-14-30-27-17-22(28)9-12-24(25)27/h4-15,17,26,29H,16,18H2,1-3H3,(H,30,31) |
| InChIKey | ZHUIPNTWFOOJDP-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.01 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|