C20H20Cl3N3 — CID 68634794
N-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-7-chloroquinolin-4-amine (PubChem CID 68634794) has the molecular formula C20H20Cl3N3 and a molecular weight of 408.76 g/mol. Its IUPAC name is N-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-7-chloroquinolin-4-amine.
| Compound Name | N-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-7-chloroquinolin-4-amine |
|---|---|
| PubChem CID | 68634794 |
| Molecular Formula | C20H20Cl3N3 |
| Molecular Weight | 408.76 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[[4-[bis(2-chloroethyl)amino]phenyl]methyl]-7-chloroquinolin-4-amine |
| SMILES | ClCCN(CCCl)c1ccc(CNc2ccnc3cc(Cl)ccc23)cc1 |
| InChI | InChI=1S/C20H20Cl3N3/c21-8-11-26(12-9-22)17-4-1-15(2-5-17)14-25-19-7-10-24-20-13-16(23)3-6-18(19)20/h1-7,10,13H,8-9,11-12,14H2,(H,24,25) |
| InChIKey | SELBZSKRENCCGL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.76 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|