C13H16N2 — CID 71072403
7-methyl-N-propylquinolin-4-amine (PubChem CID 71072403) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 7-methyl-N-propylquinolin-4-amine.
| Compound Name | 7-methyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 71072403 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 7-methyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1ccnc2cc(C)ccc12 |
| InChI | InChI=1S/C13H16N2/c1-3-7-14-12-6-8-15-13-9-10(2)4-5-11(12)13/h4-6,8-9H,3,7H2,1-2H3,(H,14,15) |
| InChIKey | NMJWGAZGOXYKAS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |