C14H18N2 — CID 62190648
5,7-dimethyl-N-propylquinolin-4-amine (PubChem CID 62190648) has the molecular formula C14H18N2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 5,7-dimethyl-N-propylquinolin-4-amine.
| Compound Name | 5,7-dimethyl-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 62190648 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 5,7-dimethyl-N-propylquinolin-4-amine |
| SMILES | CCCNc1ccnc2cc(C)cc(C)c12 |
| InChI | InChI=1S/C14H18N2/c1-4-6-15-12-5-7-16-13-9-10(2)8-11(3)14(12)13/h5,7-9H,4,6H2,1-3H3,(H,15,16) |
| InChIKey | SKGFBYWIFBMAAN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |