C12H12F2N2 — CID 62190279
6,7-difluoro-N-propylquinolin-4-amine (PubChem CID 62190279) has the molecular formula C12H12F2N2 and a molecular weight of 222.24 g/mol. Its IUPAC name is 6,7-difluoro-N-propylquinolin-4-amine.
| Compound Name | 6,7-difluoro-N-propylquinolin-4-amine |
|---|---|
| PubChem CID | 62190279 |
| Molecular Formula | C12H12F2N2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 6,7-difluoro-N-propylquinolin-4-amine |
| SMILES | CCCNc1ccnc2cc(F)c(F)cc12 |
| InChI | InChI=1S/C12H12F2N2/c1-2-4-15-11-3-5-16-12-7-10(14)9(13)6-8(11)12/h3,5-7H,2,4H2,1H3,(H,15,16) |
| InChIKey | PYQBNAPPXJNWKH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |