C16H22FN3O — CID 167836399
1-N-(7-fluoro-6-methoxyquinolin-4-yl)-4-methylpentane-1,4-diamine (PubChem CID 167836399) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is 1-N-(7-fluoro-6-methoxyquinolin-4-yl)-4-methylpentane-1,4-diamine.
| Compound Name | 1-N-(7-fluoro-6-methoxyquinolin-4-yl)-4-methylpentane-1,4-diamine |
|---|---|
| PubChem CID | 167836399 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-N-(7-fluoro-6-methoxyquinolin-4-yl)-4-methylpentane-1,4-diamine |
| SMILES | COc1cc2c(NCCCC(C)(C)N)ccnc2cc1F |
| InChI | InChI=1S/C16H22FN3O/c1-16(2,18)6-4-7-19-13-5-8-20-14-10-12(17)15(21-3)9-11(13)14/h5,8-10H,4,6-7,18H2,1-3H3,(H,19,20) |
| InChIKey | FQGMHPWMXZTSCS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|