About N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine
N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine (PubChem CID 154864206) has the molecular formula C19H20FN3O2
and a molecular weight of 341.39 g/mol. Its IUPAC name is N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine |
| PubChem CID | 154864206 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNc2ccnc3cc(F)ccc23)cc(OC)c1 |
| InChI | InChI=1S/C19H20FN3O2/c1-24-15-10-14(11-16(12-15)25-2)21-7-8-23-18-5-6-22-19-9-13(20)3-4-17(18)19/h3-6,9-12,21H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | VPMGBFSKEGIUKC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine?
The IUPAC name of N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine (CID 154864206) is N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine.
What is the SMILES notation for N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine?
The canonical SMILES for N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine is COc1cc(NCCNc2ccnc3cc(F)ccc23)cc(OC)c1.
What is the InChIKey of N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine?
The InChIKey is VPMGBFSKEGIUKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FN3O2/c1-24-15-10-14(11-16(12-15)25-2)21-7-8-23-18-5-6-22-19-9-13(20)3-4-17(18)19/h3-6,9-12,21H,7-8H2,1-2H3,(H,22,23).
What are the key properties of N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine?
N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine has a molecular weight of 341.39 g/mol, XLogP of 3.92, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine is sourced from PubChem (CID 154864206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).