C19H20FN3O2 — CID 154864206
N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine (PubChem CID 154864206) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine.
| Compound Name | N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 154864206 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | N'-(3,5-dimethoxyphenyl)-N-(7-fluoroquinolin-4-yl)ethane-1,2-diamine |
| SMILES | COc1cc(NCCNc2ccnc3cc(F)ccc23)cc(OC)c1 |
| InChI | InChI=1S/C19H20FN3O2/c1-24-15-10-14(11-16(12-15)25-2)21-7-8-23-18-5-6-22-19-9-13(20)3-4-17(18)19/h3-6,9-12,21H,7-8H2,1-2H3,(H,22,23) |
| InChIKey | VPMGBFSKEGIUKC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 55.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|