C14H15FN2 — CID 133324339
N-(2-cyclopropylethyl)-7-fluoroquinolin-4-amine (PubChem CID 133324339) has the molecular formula C14H15FN2 and a molecular weight of 230.29 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-7-fluoroquinolin-4-amine.
| Compound Name | N-(2-cyclopropylethyl)-7-fluoroquinolin-4-amine |
|---|---|
| PubChem CID | 133324339 |
| Molecular Formula | C14H15FN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | N-(2-cyclopropylethyl)-7-fluoroquinolin-4-amine |
| SMILES | Fc1ccc2c(NCCC3CC3)ccnc2c1 |
| InChI | InChI=1S/C14H15FN2/c15-11-3-4-12-13(6-8-17-14(12)9-11)16-7-5-10-1-2-10/h3-4,6,8-10H,1-2,5,7H2,(H,16,17) |
| InChIKey | ILZPJYBQWSKEMT-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |