C17H16FN3 — CID 103000463
4-N-[2-(3-fluorophenyl)ethyl]quinoline-4,7-diamine (PubChem CID 103000463) has the molecular formula C17H16FN3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-N-[2-(3-fluorophenyl)ethyl]quinoline-4,7-diamine.
| Compound Name | 4-N-[2-(3-fluorophenyl)ethyl]quinoline-4,7-diamine |
|---|---|
| PubChem CID | 103000463 |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-N-[2-(3-fluorophenyl)ethyl]quinoline-4,7-diamine |
| SMILES | Nc1ccc2c(NCCc3cccc(F)c3)ccnc2c1 |
| InChI | InChI=1S/C17H16FN3/c18-13-3-1-2-12(10-13)6-8-20-16-7-9-21-17-11-14(19)4-5-15(16)17/h1-5,7,9-11H,6,8,19H2,(H,20,21) |
| InChIKey | JYFULIHZRGLLLR-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|