C23H23ClN6O — CID 163858785
2-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-N-(3-methoxy-5-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 163858785) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is 2-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-N-(3-methoxy-5-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-N-(3-methoxy-5-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 163858785 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-N-(3-methoxy-5-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(C)cc(Nc2ccnc(NCCNc3ccnc4cc(Cl)ccc34)n2)c1 |
| InChI | InChI=1S/C23H23ClN6O/c1-15-11-17(14-18(12-15)31-2)29-22-6-8-27-23(30-22)28-10-9-26-20-5-7-25-21-13-16(24)3-4-19(20)21/h3-8,11-14H,9-10H2,1-2H3,(H,25,26)(H2,27,28,29,30) |
| InChIKey | NRXILTLKAPJPEH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|