C19H23ClN6O — CID 127048435
4-[[4-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]pyrimidin-2-yl]amino]butan-1-ol (PubChem CID 127048435) has the molecular formula C19H23ClN6O and a molecular weight of 386.89 g/mol. Its IUPAC name is 4-[[4-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]pyrimidin-2-yl]amino]butan-1-ol.
| Compound Name | 4-[[4-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]pyrimidin-2-yl]amino]butan-1-ol |
|---|---|
| PubChem CID | 127048435 |
| Molecular Formula | C19H23ClN6O |
| Molecular Weight | 386.89 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 4-[[4-[2-[(7-chloroquinolin-4-yl)amino]ethylamino]pyrimidin-2-yl]amino]butan-1-ol |
| SMILES | OCCCCNc1nccc(NCCNc2ccnc3cc(Cl)ccc23)n1 |
| InChI | InChI=1S/C19H23ClN6O/c20-14-3-4-15-16(5-8-21-17(15)13-14)22-10-11-23-18-6-9-25-19(26-18)24-7-1-2-12-27/h3-6,8-9,13,27H,1-2,7,10-12H2,(H,21,22)(H2,23,24,25,26) |
| InChIKey | ZLRKGMRIBSGTSV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.89 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|