C25H28ClN5 — CID 91884589
N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[3-(quinolin-2-ylamino)propyl]propane-1,3-diamine (PubChem CID 91884589) has the molecular formula C25H28ClN5 and a molecular weight of 433.99 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[3-(quinolin-2-ylamino)propyl]propane-1,3-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[3-(quinolin-2-ylamino)propyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 91884589 |
| Molecular Formula | C25H28ClN5 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-methyl-N'-[3-(quinolin-2-ylamino)propyl]propane-1,3-diamine |
| SMILES | CN(CCCNc1ccc2ccccc2n1)CCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C25H28ClN5/c1-31(17-5-14-29-25-11-8-19-6-2-3-7-22(19)30-25)16-4-13-27-23-12-15-28-24-18-20(26)9-10-21(23)24/h2-3,6-12,15,18H,4-5,13-14,16-17H2,1H3,(H,27,28)(H,29,30) |
| InChIKey | MTPIAGPSTYVUFS-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|