C16H18ClN7 — CID 71508321
4-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]pyrimidine-2,4,6-triamine (PubChem CID 71508321) has the molecular formula C16H18ClN7 and a molecular weight of 343.82 g/mol. Its IUPAC name is 4-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]pyrimidine-2,4,6-triamine.
| Compound Name | 4-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 71508321 |
| Molecular Formula | C16H18ClN7 |
| Molecular Weight | 343.82 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]pyrimidine-2,4,6-triamine |
| SMILES | Nc1cc(NCCCNc2ccnc3cc(Cl)ccc23)nc(N)n1 |
| InChI | InChI=1S/C16H18ClN7/c17-10-2-3-11-12(4-7-21-13(11)8-10)20-5-1-6-22-15-9-14(18)23-16(19)24-15/h2-4,7-9H,1,5-6H2,(H,20,21)(H5,18,19,22,23,24) |
| InChIKey | YTWZZYQNAMZZBH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 114.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.82 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|