C23H29ClN6 — CID 70691269
N-(7-chloroquinolin-4-yl)-N'-(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)butane-1,4-diamine (PubChem CID 70691269) has the molecular formula C23H29ClN6 and a molecular weight of 424.98 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)butane-1,4-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)butane-1,4-diamine |
|---|---|
| PubChem CID | 70691269 |
| Molecular Formula | C23H29ClN6 |
| Molecular Weight | 424.98 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-(6-methyl-2-piperidin-1-ylpyrimidin-4-yl)butane-1,4-diamine |
| SMILES | Cc1cc(NCCCCNc2ccnc3cc(Cl)ccc23)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C23H29ClN6/c1-17-15-22(29-23(28-17)30-13-5-2-6-14-30)27-11-4-3-10-25-20-9-12-26-21-16-18(24)7-8-19(20)21/h7-9,12,15-16H,2-6,10-11,13-14H2,1H3,(H,25,26)(H,27,28,29) |
| InChIKey | VSAAMHSEPFFXOA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.98 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|