C21H26ClN7 — CID 127050646
N-(7-chloroquinolin-4-yl)-N'-[2-(4-ethylpiperazin-1-yl)pyrimidin-4-yl]ethane-1,2-diamine (PubChem CID 127050646) has the molecular formula C21H26ClN7 and a molecular weight of 411.94 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-[2-(4-ethylpiperazin-1-yl)pyrimidin-4-yl]ethane-1,2-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-[2-(4-ethylpiperazin-1-yl)pyrimidin-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 127050646 |
| Molecular Formula | C21H26ClN7 |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-[2-(4-ethylpiperazin-1-yl)pyrimidin-4-yl]ethane-1,2-diamine |
| SMILES | CCN1CCN(c2nccc(NCCNc3ccnc4cc(Cl)ccc34)n2)CC1 |
| InChI | InChI=1S/C21H26ClN7/c1-2-28-11-13-29(14-12-28)21-26-8-6-20(27-21)25-10-9-24-18-5-7-23-19-15-16(22)3-4-17(18)19/h3-8,15H,2,9-14H2,1H3,(H,23,24)(H,25,26,27) |
| InChIKey | ZTOAIFICXCFBOJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|