C23H27ClF3N7 — CID 155808671
N-(7-chloroquinolin-4-yl)-N'-[4-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]propane-1,3-diamine (PubChem CID 155808671) has the molecular formula C23H27ClF3N7 and a molecular weight of 493.97 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-[4-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]propane-1,3-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-[4-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 155808671 |
| Molecular Formula | C23H27ClF3N7 |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-[4-(4-ethylpiperazin-1-yl)-6-(trifluoromethyl)pyrimidin-2-yl]propane-1,3-diamine |
| SMILES | CCN1CCN(c2cc(C(F)(F)F)nc(NCCCNc3ccnc4cc(Cl)ccc34)n2)CC1 |
| InChI | InChI=1S/C23H27ClF3N7/c1-2-33-10-12-34(13-11-33)21-15-20(23(25,26)27)31-22(32-21)30-8-3-7-28-18-6-9-29-19-14-16(24)4-5-17(18)19/h4-6,9,14-15H,2-3,7-8,10-13H2,1H3,(H,28,29)(H,30,31,32) |
| InChIKey | OSICCMNMNJQBTQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|