C22H24ClF3N6 — CID 155809149
N-(7-chloroquinolin-4-yl)-N'-[4-piperidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]propane-1,3-diamine (PubChem CID 155809149) has the molecular formula C22H24ClF3N6 and a molecular weight of 464.92 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-[4-piperidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]propane-1,3-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-[4-piperidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 155809149 |
| Molecular Formula | C22H24ClF3N6 |
| Molecular Weight | 464.92 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-[4-piperidin-1-yl-6-(trifluoromethyl)pyrimidin-2-yl]propane-1,3-diamine |
| SMILES | FC(F)(F)c1cc(N2CCCCC2)nc(NCCCNc2ccnc3cc(Cl)ccc23)n1 |
| InChI | InChI=1S/C22H24ClF3N6/c23-15-5-6-16-17(7-10-28-18(16)13-15)27-8-4-9-29-21-30-19(22(24,25)26)14-20(31-21)32-11-2-1-3-12-32/h5-7,10,13-14H,1-4,8-9,11-12H2,(H,27,28)(H,29,30,31) |
| InChIKey | NVNNZQOYECXNKS-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.92 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|