C22H23ClF3N5 — CID 46240744
7-chloro-N-[3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propyl]quinolin-4-amine (PubChem CID 46240744) has the molecular formula C22H23ClF3N5 and a molecular weight of 449.91 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 46240744 |
| Molecular Formula | C22H23ClF3N5 |
| Molecular Weight | 449.91 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | 7-chloro-N-[3-[4-[5-(trifluoromethyl)-2-pyridinyl]piperazin-1-yl]propyl]quinolin-4-amine |
| SMILES | FC(F)(F)c1ccc(N2CCN(CCCNc3ccnc4cc(Cl)ccc34)CC2)nc1 |
| InChI | InChI=1S/C22H23ClF3N5/c23-17-3-4-18-19(6-8-28-20(18)14-17)27-7-1-9-30-10-12-31(13-11-30)21-5-2-16(15-29-21)22(24,25)26/h2-6,8,14-15H,1,7,9-13H2,(H,27,28) |
| InChIKey | JKFUQTMBJMHSJP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|