C23H36ClN5 — CID 11112538
N-[3-[4-[3-(butylamino)propyl]piperazin-1-yl]propyl]-7-chloroquinolin-4-amine (PubChem CID 11112538) has the molecular formula C23H36ClN5 and a molecular weight of 418.03 g/mol. Its IUPAC name is N-[3-[4-[3-(butylamino)propyl]piperazin-1-yl]propyl]-7-chloroquinolin-4-amine.
| Compound Name | N-[3-[4-[3-(butylamino)propyl]piperazin-1-yl]propyl]-7-chloroquinolin-4-amine |
|---|---|
| PubChem CID | 11112538 |
| Molecular Formula | C23H36ClN5 |
| Molecular Weight | 418.03 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | N-[3-[4-[3-(butylamino)propyl]piperazin-1-yl]propyl]-7-chloroquinolin-4-amine |
| SMILES | CCCCNCCCN1CCN(CCCNc2ccnc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C23H36ClN5/c1-2-3-9-25-10-4-13-28-15-17-29(18-16-28)14-5-11-26-22-8-12-27-23-19-20(24)6-7-21(22)23/h6-8,12,19,25H,2-5,9-11,13-18H2,1H3,(H,26,27) |
| InChIKey | YECPQDIJDOJYFH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.03 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|