C29H30Cl2N4 — CID 11995957
7-chloro-N-[3-[4-(N-(4-chlorophenyl)anilino)piperidin-1-yl]propyl]quinolin-4-amine (PubChem CID 11995957) has the molecular formula C29H30Cl2N4 and a molecular weight of 505.49 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-(N-(4-chlorophenyl)anilino)piperidin-1-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[4-(N-(4-chlorophenyl)anilino)piperidin-1-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 11995957 |
| Molecular Formula | C29H30Cl2N4 |
| Molecular Weight | 505.49 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | 7-chloro-N-[3-[4-(N-(4-chlorophenyl)anilino)piperidin-1-yl]propyl]quinolin-4-amine |
| SMILES | Clc1ccc(N(c2ccccc2)C2CCN(CCCNc3ccnc4cc(Cl)ccc34)CC2)cc1 |
| InChI | InChI=1S/C29H30Cl2N4/c30-22-7-10-25(11-8-22)35(24-5-2-1-3-6-24)26-14-19-34(20-15-26)18-4-16-32-28-13-17-33-29-21-23(31)9-12-27(28)29/h1-3,5-13,17,21,26H,4,14-16,18-20H2,(H,32,33) |
| InChIKey | PHQOHTQQQZTLHW-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.49 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|