C27H32ClN7 — CID 58476694
7-chloro-N-[3-[4-[1H-imidazol-2-ylmethyl(pyridin-4-ylmethyl)amino]piperidin-1-yl]propyl]quinolin-4-amine (PubChem CID 58476694) has the molecular formula C27H32ClN7 and a molecular weight of 490.06 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-[1H-imidazol-2-ylmethyl(pyridin-4-ylmethyl)amino]piperidin-1-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[4-[1H-imidazol-2-ylmethyl(pyridin-4-ylmethyl)amino]piperidin-1-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 58476694 |
| Molecular Formula | C27H32ClN7 |
| Molecular Weight | 490.06 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 7-chloro-N-[3-[4-[1H-imidazol-2-ylmethyl(pyridin-4-ylmethyl)amino]piperidin-1-yl]propyl]quinolin-4-amine |
| SMILES | Clc1ccc2c(NCCCN3CCC(N(Cc4ccncc4)Cc4ncc[nH]4)CC3)ccnc2c1 |
| InChI | InChI=1S/C27H32ClN7/c28-22-2-3-24-25(6-12-31-26(24)18-22)30-9-1-15-34-16-7-23(8-17-34)35(20-27-32-13-14-33-27)19-21-4-10-29-11-5-21/h2-6,10-14,18,23H,1,7-9,15-17,19-20H2,(H,30,31)(H,32,33) |
| InChIKey | PCYKUMIOVUFSAW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.06 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|