C33H45ClN6 — CID 143278301
N-[3-[4-[(4-aminocyclohexa-1,5-dien-1-yl)methyl-[(4-aminophenyl)methyl]amino]piperidin-1-yl]propyl]-7-chloroquinolin-4-amine;ethane (PubChem CID 143278301) has the molecular formula C33H45ClN6 and a molecular weight of 561.22 g/mol. Its IUPAC name is N-[3-[4-[(4-aminocyclohexa-1,5-dien-1-yl)methyl-[(4-aminophenyl)methyl]amino]piperidin-1-yl]propyl]-7-chloroquinolin-4-amine;ethane.
| Compound Name | N-[3-[4-[(4-aminocyclohexa-1,5-dien-1-yl)methyl-[(4-aminophenyl)methyl]amino]piperidin-1-yl]propyl]-7-chloroquinolin-4-amine;ethane |
|---|---|
| PubChem CID | 143278301 |
| Molecular Formula | C33H45ClN6 |
| Molecular Weight | 561.22 g/mol |
| Exact Mass | 560.34 |
| IUPAC Name | N-[3-[4-[(4-aminocyclohexa-1,5-dien-1-yl)methyl-[(4-aminophenyl)methyl]amino]piperidin-1-yl]propyl]-7-chloroquinolin-4-amine;ethane |
| SMILES | CC.Nc1ccc(CN(CC2=CCC(N)C=C2)C2CCN(CCCNc3ccnc4cc(Cl)ccc34)CC2)cc1 |
| InChI | InChI=1S/C31H39ClN6.C2H6/c32-25-6-11-29-30(12-16-36-31(29)20-25)35-15-1-17-37-18-13-28(14-19-37)38(21-23-2-7-26(33)8-3-23)22-24-4-9-27(34)10-5-24;1-2/h2-9,11-12,16,20,27-28H,1,10,13-15,17-19,21-22,33-34H2,(H,35,36);1-2H3 |
| InChIKey | XTRFJKBFAAPVQI-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.22 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|