C26H35ClN8 — CID 46227634
4-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-N-cyclohexyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine (PubChem CID 46227634) has the molecular formula C26H35ClN8 and a molecular weight of 495.08 g/mol. Its IUPAC name is 4-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-N-cyclohexyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-N-cyclohexyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 46227634 |
| Molecular Formula | C26H35ClN8 |
| Molecular Weight | 495.08 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 4-N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2-N-cyclohexyl-6-piperidin-1-yl-1,3,5-triazine-2,4-diamine |
| SMILES | Clc1ccc2c(NCCCNc3nc(NC4CCCCC4)nc(N4CCCCC4)n3)ccnc2c1 |
| InChI | InChI=1S/C26H35ClN8/c27-19-10-11-21-22(12-15-29-23(21)18-19)28-13-7-14-30-24-32-25(31-20-8-3-1-4-9-20)34-26(33-24)35-16-5-2-6-17-35/h10-12,15,18,20H,1-9,13-14,16-17H2,(H,28,29)(H2,30,31,32,33,34) |
| InChIKey | FSLZCBOHTZWSIV-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.08 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|