C26H27ClFN7 — CID 158771668
7-chloro-N-[3-[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]propyl]quinolin-4-amine (PubChem CID 158771668) has the molecular formula C26H27ClFN7 and a molecular weight of 492.00 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 158771668 |
| Molecular Formula | C26H27ClFN7 |
| Molecular Weight | 492.00 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | 7-chloro-N-[3-[4-(4-fluoroanilino)-6-piperidin-1-yl-1,3,5-triazin-2-yl]propyl]quinolin-4-amine |
| SMILES | Fc1ccc(Nc2nc(CCCNc3ccnc4cc(Cl)ccc34)nc(N3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C26H27ClFN7/c27-18-6-11-21-22(12-14-30-23(21)17-18)29-13-4-5-24-32-25(31-20-9-7-19(28)8-10-20)34-26(33-24)35-15-2-1-3-16-35/h6-12,14,17H,1-5,13,15-16H2,(H,29,30)(H,31,32,33,34) |
| InChIKey | HGYWOWONDZQNGE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.00 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|