C25H25ClFN7O — CID 146733627
7-chloro-N-[3-[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]propyl]quinolin-4-amine (PubChem CID 146733627) has the molecular formula C25H25ClFN7O and a molecular weight of 493.97 g/mol. Its IUPAC name is 7-chloro-N-[3-[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]propyl]quinolin-4-amine.
| Compound Name | 7-chloro-N-[3-[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]propyl]quinolin-4-amine |
|---|---|
| PubChem CID | 146733627 |
| Molecular Formula | C25H25ClFN7O |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.18 |
| IUPAC Name | 7-chloro-N-[3-[4-(4-fluoroanilino)-6-morpholin-4-yl-1,3,5-triazin-2-yl]propyl]quinolin-4-amine |
| SMILES | Fc1ccc(Nc2nc(CCCNc3ccnc4cc(Cl)ccc34)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C25H25ClFN7O/c26-17-3-8-20-21(9-11-29-22(20)16-17)28-10-1-2-23-31-24(30-19-6-4-18(27)5-7-19)33-25(32-23)34-12-14-35-15-13-34/h3-9,11,16H,1-2,10,12-15H2,(H,28,29)(H,30,31,32,33) |
| InChIKey | RIQVAKQWDSHWBE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 88.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|