C13H13ClFN5O — CID 23381719
4-chloro-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 23381719) has the molecular formula C13H13ClFN5O and a molecular weight of 309.73 g/mol. Its IUPAC name is 4-chloro-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 23381719 |
| Molecular Formula | C13H13ClFN5O |
| Molecular Weight | 309.73 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 4-chloro-N-(4-fluorophenyl)-6-morpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Fc1ccc(Nc2nc(Cl)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C13H13ClFN5O/c14-11-17-12(16-10-3-1-9(15)2-4-10)19-13(18-11)20-5-7-21-8-6-20/h1-4H,5-8H2,(H,16,17,18,19) |
| InChIKey | RGPVKMKXCPFGBU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.73 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |