C36H42ClN11O2 — CID 45133451
2-N-(4-butylphenyl)-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine;4-chloro-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine (PubChem CID 45133451) has the molecular formula C36H42ClN11O2 and a molecular weight of 696.26 g/mol. Its IUPAC name is 2-N-(4-butylphenyl)-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine;4-chloro-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine.
| Compound Name | 2-N-(4-butylphenyl)-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine;4-chloro-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 45133451 |
| Molecular Formula | C36H42ClN11O2 |
| Molecular Weight | 696.26 g/mol |
| Exact Mass | 695.32 |
| IUPAC Name | 2-N-(4-butylphenyl)-6-morpholin-4-yl-4-N-phenyl-1,3,5-triazine-2,4-diamine;4-chloro-6-morpholin-4-yl-N-phenyl-1,3,5-triazin-2-amine |
| SMILES | CCCCc1ccc(Nc2nc(Nc3ccccc3)nc(N3CCOCC3)n2)cc1.Clc1nc(Nc2ccccc2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C23H28N6O.C13H14ClN5O/c1-2-3-7-18-10-12-20(13-11-18)25-22-26-21(24-19-8-5-4-6-9-19)27-23(28-22)29-14-16-30-17-15-29;14-11-16-12(15-10-4-2-1-3-5-10)18-13(17-11)19-6-8-20-9-7-19/h4-6,8-13H,2-3,7,14-17H2,1H3,(H2,24,25,26,27,28);1-5H,6-9H2,(H,15,16,17,18) |
| InChIKey | MQYJOPKJQOTTIR-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 138.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.26 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |