C26H29ClN8O — CID 71598239
4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-N-(4-ethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine (PubChem CID 71598239) has the molecular formula C26H29ClN8O and a molecular weight of 505.03 g/mol. Its IUPAC name is 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-N-(4-ethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine.
| Compound Name | 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-N-(4-ethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 71598239 |
| Molecular Formula | C26H29ClN8O |
| Molecular Weight | 505.03 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 4-N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-2-N-(4-ethylphenyl)-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine |
| SMILES | CCc1ccc(Nc2nc(NCCNc3ccnc4cc(Cl)ccc34)nc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C26H29ClN8O/c1-2-18-3-6-20(7-4-18)31-25-32-24(33-26(34-25)35-13-15-36-16-14-35)30-12-11-29-22-9-10-28-23-17-19(27)5-8-21(22)23/h3-10,17H,2,11-16H2,1H3,(H,28,29)(H2,30,31,32,33,34) |
| InChIKey | VAHXWUOTQJWJHF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 100.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.03 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|