C25H27ClN8O3 — CID 130261644
[3-[[4-[[(7-chloroquinolin-4-yl)amino]methylamino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-5-methoxyphenyl]methanol (PubChem CID 130261644) has the molecular formula C25H27ClN8O3 and a molecular weight of 523.00 g/mol. Its IUPAC name is [3-[[4-[[(7-chloroquinolin-4-yl)amino]methylamino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-5-methoxyphenyl]methanol.
| Compound Name | [3-[[4-[[(7-chloroquinolin-4-yl)amino]methylamino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-5-methoxyphenyl]methanol |
|---|---|
| PubChem CID | 130261644 |
| Molecular Formula | C25H27ClN8O3 |
| Molecular Weight | 523.00 g/mol |
| Exact Mass | 522.19 |
| IUPAC Name | [3-[[4-[[(7-chloroquinolin-4-yl)amino]methylamino]-6-morpholin-4-yl-1,3,5-triazin-2-yl]amino]-5-methoxyphenyl]methanol |
| SMILES | COc1cc(CO)cc(Nc2nc(NCNc3ccnc4cc(Cl)ccc34)nc(N3CCOCC3)n2)c1 |
| InChI | InChI=1S/C25H27ClN8O3/c1-36-19-11-16(14-35)10-18(13-19)30-24-31-23(32-25(33-24)34-6-8-37-9-7-34)29-15-28-21-4-5-27-22-12-17(26)2-3-20(21)22/h2-5,10-13,35H,6-9,14-15H2,1H3,(H,27,28)(H2,29,30,31,32,33) |
| InChIKey | XXLVTKFMVXOXDL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 129.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.00 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|