C31H31Cl2N9O — CID 90666705
2-N-(4-chlorophenyl)-4-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-6-N-(3-morpholin-4-ylpropyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 90666705) has the molecular formula C31H31Cl2N9O and a molecular weight of 616.56 g/mol. Its IUPAC name is 2-N-(4-chlorophenyl)-4-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-6-N-(3-morpholin-4-ylpropyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-(4-chlorophenyl)-4-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-6-N-(3-morpholin-4-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 90666705 |
| Molecular Formula | C31H31Cl2N9O |
| Molecular Weight | 616.56 g/mol |
| Exact Mass | 615.20 |
| IUPAC Name | 2-N-(4-chlorophenyl)-4-N-[4-[(7-chloroquinolin-4-yl)amino]phenyl]-6-N-(3-morpholin-4-ylpropyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | Clc1ccc(Nc2nc(NCCCN3CCOCC3)nc(Nc3ccc(Nc4ccnc5cc(Cl)ccc45)cc3)n2)cc1 |
| InChI | InChI=1S/C31H31Cl2N9O/c32-21-2-5-24(6-3-21)37-30-39-29(35-13-1-15-42-16-18-43-19-17-42)40-31(41-30)38-25-9-7-23(8-10-25)36-27-12-14-34-28-20-22(33)4-11-26(27)28/h2-12,14,20H,1,13,15-19H2,(H,34,36)(H3,35,37,38,39,40,41) |
| InChIKey | DRYJKYXRZCBBHQ-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.56 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|