C29H32ClN7O — CID 155811673
[4-[[4-[4-[(7-chloroquinolin-4-yl)amino]butylamino]pyrimidin-2-yl]amino]phenyl]-piperidin-1-ylmethanone (PubChem CID 155811673) has the molecular formula C29H32ClN7O and a molecular weight of 530.08 g/mol. Its IUPAC name is [4-[[4-[4-[(7-chloroquinolin-4-yl)amino]butylamino]pyrimidin-2-yl]amino]phenyl]-piperidin-1-ylmethanone.
| Compound Name | [4-[[4-[4-[(7-chloroquinolin-4-yl)amino]butylamino]pyrimidin-2-yl]amino]phenyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 155811673 |
| Molecular Formula | C29H32ClN7O |
| Molecular Weight | 530.08 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | [4-[[4-[4-[(7-chloroquinolin-4-yl)amino]butylamino]pyrimidin-2-yl]amino]phenyl]-piperidin-1-ylmethanone |
| SMILES | O=C(c1ccc(Nc2nccc(NCCCCNc3ccnc4cc(Cl)ccc34)n2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C29H32ClN7O/c30-22-8-11-24-25(12-16-32-26(24)20-22)31-14-2-3-15-33-27-13-17-34-29(36-27)35-23-9-6-21(7-10-23)28(38)37-18-4-1-5-19-37/h6-13,16-17,20H,1-5,14-15,18-19H2,(H,31,32)(H2,33,34,35,36) |
| InChIKey | HBUDAWBXHOAJQX-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 95.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.08 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|