C24H23ClN6O — CID 100778803
N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide (PubChem CID 100778803) has the molecular formula C24H23ClN6O and a molecular weight of 446.94 g/mol. Its IUPAC name is N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide.
| Compound Name | N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 100778803 |
| Molecular Formula | C24H23ClN6O |
| Molecular Weight | 446.94 g/mol |
| Exact Mass | 446.16 |
| IUPAC Name | N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-[(4,6-dimethylpyrimidin-2-yl)amino]benzamide |
| SMILES | Cc1cc(C)nc(Nc2ccc(C(=O)NCCNc3ccnc4cc(Cl)ccc34)cc2)n1 |
| InChI | InChI=1S/C24H23ClN6O/c1-15-13-16(2)30-24(29-15)31-19-6-3-17(4-7-19)23(32)28-12-11-27-21-9-10-26-22-14-18(25)5-8-20(21)22/h3-10,13-14H,11-12H2,1-2H3,(H,26,27)(H,28,32)(H,29,30,31) |
| InChIKey | VLWIMRILTYZVJA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|