C21H18ClN5OS — CID 100769211
N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 100769211) has the molecular formula C21H18ClN5OS and a molecular weight of 423.93 g/mol. Its IUPAC name is N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 100769211 |
| Molecular Formula | C21H18ClN5OS |
| Molecular Weight | 423.93 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-4-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1nc(-c2cccnc2)sc1C(=O)NCCNc1ccnc2cc(Cl)ccc12 |
| InChI | InChI=1S/C21H18ClN5OS/c1-13-19(29-21(27-13)14-3-2-7-23-12-14)20(28)26-10-9-25-17-6-8-24-18-11-15(22)4-5-16(17)18/h2-8,11-12H,9-10H2,1H3,(H,24,25)(H,26,28) |
| InChIKey | NZFNKEFJOFLPBQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.93 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|