C21H17ClN4O2 — CID 100776891
N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-5-phenyl-1,2-oxazole-3-carboxamide (PubChem CID 100776891) has the molecular formula C21H17ClN4O2 and a molecular weight of 392.85 g/mol. Its IUPAC name is N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-5-phenyl-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-5-phenyl-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 100776891 |
| Molecular Formula | C21H17ClN4O2 |
| Molecular Weight | 392.85 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | N-[2-[(7-chloroquinolin-4-yl)amino]ethyl]-5-phenyl-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCNc1ccnc2cc(Cl)ccc12)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C21H17ClN4O2/c22-15-6-7-16-17(8-9-23-18(16)12-15)24-10-11-25-21(27)19-13-20(28-26-19)14-4-2-1-3-5-14/h1-9,12-13H,10-11H2,(H,23,24)(H,25,27) |
| InChIKey | MYOQGPCJDJQUMI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.85 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|