C31H30Cl2N6O — CID 42707271
N-[2-[bis[2-[(7-chloroquinolin-4-yl)amino]ethyl]amino]ethyl]benzamide (PubChem CID 42707271) has the molecular formula C31H30Cl2N6O and a molecular weight of 573.53 g/mol. Its IUPAC name is N-[2-[bis[2-[(7-chloroquinolin-4-yl)amino]ethyl]amino]ethyl]benzamide.
| Compound Name | N-[2-[bis[2-[(7-chloroquinolin-4-yl)amino]ethyl]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 42707271 |
| Molecular Formula | C31H30Cl2N6O |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 572.19 |
| IUPAC Name | N-[2-[bis[2-[(7-chloroquinolin-4-yl)amino]ethyl]amino]ethyl]benzamide |
| SMILES | O=C(NCCN(CCNc1ccnc2cc(Cl)ccc12)CCNc1ccnc2cc(Cl)ccc12)c1ccccc1 |
| InChI | InChI=1S/C31H30Cl2N6O/c32-23-6-8-25-27(10-12-34-29(25)20-23)36-14-17-39(19-16-38-31(40)22-4-2-1-3-5-22)18-15-37-28-11-13-35-30-21-24(33)7-9-26(28)30/h1-13,20-21H,14-19H2,(H,34,36)(H,35,37)(H,38,40) |
| InChIKey | DUTOVGMPKQSQRW-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |